About 3-ethenyl-4-nonyloxolane
3-ethenyl-4-nonyloxolane (PubChem CID 23010493) has the molecular formula C15H28O
and a molecular weight of 224.39 g/mol. Its IUPAC name is 3-ethenyl-4-nonyloxolane.
Molecular Properties
| Compound Name | 3-ethenyl-4-nonyloxolane |
| PubChem CID | 23010493 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 3-ethenyl-4-nonyloxolane |
| SMILES | C=CC1COCC1CCCCCCCCC |
| InChI | InChI=1S/C15H28O/c1-3-5-6-7-8-9-10-11-15-13-16-12-14(15)4-2/h4,14-15H,2-3,5-13H2,1H3 |
| InChIKey | NWGTUGAHNPKBGS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-4-nonyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-4-nonyloxolane?
The IUPAC name of 3-ethenyl-4-nonyloxolane (CID 23010493) is 3-ethenyl-4-nonyloxolane.
What is the SMILES notation for 3-ethenyl-4-nonyloxolane?
The canonical SMILES for 3-ethenyl-4-nonyloxolane is C=CC1COCC1CCCCCCCCC.
What is the InChIKey of 3-ethenyl-4-nonyloxolane?
The InChIKey is NWGTUGAHNPKBGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O/c1-3-5-6-7-8-9-10-11-15-13-16-12-14(15)4-2/h4,14-15H,2-3,5-13H2,1H3.
What are the key properties of 3-ethenyl-4-nonyloxolane?
3-ethenyl-4-nonyloxolane has a molecular weight of 224.39 g/mol, XLogP of 4.58, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-4-nonyloxolane is sourced from PubChem (CID 23010493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).