C13H24O3 — CID 171064910
2-hexyl-5-prop-2-enoxy-1,3-dioxane (PubChem CID 171064910) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 2-hexyl-5-prop-2-enoxy-1,3-dioxane.
| Compound Name | 2-hexyl-5-prop-2-enoxy-1,3-dioxane |
|---|---|
| PubChem CID | 171064910 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-hexyl-5-prop-2-enoxy-1,3-dioxane |
| SMILES | C=CCOC1COC(CCCCCC)OC1 |
| InChI | InChI=1S/C13H24O3/c1-3-5-6-7-8-13-15-10-12(11-16-13)14-9-4-2/h4,12-13H,2-3,5-11H2,1H3 |
| InChIKey | KNXCTGAGMPCAKQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|