C15H20N4O — CID 121293848
2,3-dimethyl-4-[[(3R)-pyrrolidin-3-yl]amino]-1H-indole-7-carboxamide (PubChem CID 121293848) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 2,3-dimethyl-4-[[(3R)-pyrrolidin-3-yl]amino]-1H-indole-7-carboxamide.
| Compound Name | 2,3-dimethyl-4-[[(3R)-pyrrolidin-3-yl]amino]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 121293848 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2,3-dimethyl-4-[[(3R)-pyrrolidin-3-yl]amino]-1H-indole-7-carboxamide |
| SMILES | Cc1[nH]c2c(C(N)=O)ccc(N[C@@H]3CCNC3)c2c1C |
| InChI | InChI=1S/C15H20N4O/c1-8-9(2)18-14-11(15(16)20)3-4-12(13(8)14)19-10-5-6-17-7-10/h3-4,10,17-19H,5-7H2,1-2H3,(H2,16,20)/t10-/m1/s1 |
| InChIKey | UNIHIDFRTYKSJP-SNVBAGLBSA-N |
| XLogP | 1.66 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |