C19H22N4O2 — CID 121294051
2,3-dimethyl-4-[(1-prop-2-ynoylpiperidin-4-yl)amino]-1H-indole-7-carboxamide (PubChem CID 121294051) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2,3-dimethyl-4-[(1-prop-2-ynoylpiperidin-4-yl)amino]-1H-indole-7-carboxamide.
| Compound Name | 2,3-dimethyl-4-[(1-prop-2-ynoylpiperidin-4-yl)amino]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 121294051 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2,3-dimethyl-4-[(1-prop-2-ynoylpiperidin-4-yl)amino]-1H-indole-7-carboxamide |
| SMILES | C#CC(=O)N1CCC(Nc2ccc(C(N)=O)c3[nH]c(C)c(C)c23)CC1 |
| InChI | InChI=1S/C19H22N4O2/c1-4-16(24)23-9-7-13(8-10-23)22-15-6-5-14(19(20)25)18-17(15)11(2)12(3)21-18/h1,5-6,13,21-22H,7-10H2,2-3H3,(H2,20,25) |
| InChIKey | RRVWOHOZIVWEIW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|