C19H21FN4O2 — CID 121294057
4-[(3S)-3-(but-2-ynoylamino)pyrrolidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide (PubChem CID 121294057) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is 4-[(3S)-3-(but-2-ynoylamino)pyrrolidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide.
| Compound Name | 4-[(3S)-3-(but-2-ynoylamino)pyrrolidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 121294057 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 4-[(3S)-3-(but-2-ynoylamino)pyrrolidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide |
| SMILES | CC#CC(=O)N[C@H]1CCN(c2c(F)cc(C(N)=O)c3[nH]c(C)c(C)c23)C1 |
| InChI | InChI=1S/C19H21FN4O2/c1-4-5-15(25)23-12-6-7-24(9-12)18-14(20)8-13(19(21)26)17-16(18)10(2)11(3)22-17/h8,12,22H,6-7,9H2,1-3H3,(H2,21,26)(H,23,25)/t12-/m0/s1 |
| InChIKey | YWHPGNMYLOEDST-LBPRGKRZSA-N |
| XLogP | 1.74 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|