C22H24FN3O2 — CID 175957975
5-fluoro-2,3-dimethyl-4-[(5S)-5-(pent-2-ynoylamino)cyclohexen-1-yl]-1H-indole-7-carboxamide (PubChem CID 175957975) has the molecular formula C22H24FN3O2 and a molecular weight of 381.45 g/mol. Its IUPAC name is 5-fluoro-2,3-dimethyl-4-[(5S)-5-(pent-2-ynoylamino)cyclohexen-1-yl]-1H-indole-7-carboxamide.
| Compound Name | 5-fluoro-2,3-dimethyl-4-[(5S)-5-(pent-2-ynoylamino)cyclohexen-1-yl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 175957975 |
| Molecular Formula | C22H24FN3O2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 5-fluoro-2,3-dimethyl-4-[(5S)-5-(pent-2-ynoylamino)cyclohexen-1-yl]-1H-indole-7-carboxamide |
| SMILES | CCC#CC(=O)N[C@H]1CCC=C(c2c(F)cc(C(N)=O)c3[nH]c(C)c(C)c23)C1 |
| InChI | InChI=1S/C22H24FN3O2/c1-4-5-9-18(27)26-15-8-6-7-14(10-15)20-17(23)11-16(22(24)28)21-19(20)12(2)13(3)25-21/h7,11,15,25H,4,6,8,10H2,1-3H3,(H2,24,28)(H,26,27)/t15-/m0/s1 |
| InChIKey | HQARDSGWMQOTJU-HNNXBMFYSA-N |
| XLogP | 3.49 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|