C20H21ClFN3O2 — CID 164585673
but-2-ynamide;3-chloro-4-(cyclohexen-1-yl)-5-fluoro-2-methyl-1H-indole-7-carboxamide (PubChem CID 164585673) has the molecular formula C20H21ClFN3O2 and a molecular weight of 389.86 g/mol. Its IUPAC name is but-2-ynamide;3-chloro-4-(cyclohexen-1-yl)-5-fluoro-2-methyl-1H-indole-7-carboxamide.
| Compound Name | but-2-ynamide;3-chloro-4-(cyclohexen-1-yl)-5-fluoro-2-methyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 164585673 |
| Molecular Formula | C20H21ClFN3O2 |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | but-2-ynamide;3-chloro-4-(cyclohexen-1-yl)-5-fluoro-2-methyl-1H-indole-7-carboxamide |
| SMILES | CC#CC(N)=O.Cc1[nH]c2c(C(N)=O)cc(F)c(C3=CCCCC3)c2c1Cl |
| InChI | InChI=1S/C16H16ClFN2O.C4H5NO/c1-8-14(17)13-12(9-5-3-2-4-6-9)11(18)7-10(16(19)21)15(13)20-8;1-2-3-4(5)6/h5,7,20H,2-4,6H2,1H3,(H2,19,21);1H3,(H2,5,6) |
| InChIKey | GOLSEMQMJGYHPM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|