C20H21ClF2N4O2 — CID 168842054
4-[(3S,5S)-3-[but-2-ynoyl(methyl)amino]-5-fluoropiperidin-1-yl]-3-chloro-5-fluoro-2-methyl-1H-indole-7-carboxamide (PubChem CID 168842054) has the molecular formula C20H21ClF2N4O2 and a molecular weight of 422.86 g/mol. Its IUPAC name is 4-[(3S,5S)-3-[but-2-ynoyl(methyl)amino]-5-fluoropiperidin-1-yl]-3-chloro-5-fluoro-2-methyl-1H-indole-7-carboxamide.
| Compound Name | 4-[(3S,5S)-3-[but-2-ynoyl(methyl)amino]-5-fluoropiperidin-1-yl]-3-chloro-5-fluoro-2-methyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 168842054 |
| Molecular Formula | C20H21ClF2N4O2 |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 4-[(3S,5S)-3-[but-2-ynoyl(methyl)amino]-5-fluoropiperidin-1-yl]-3-chloro-5-fluoro-2-methyl-1H-indole-7-carboxamide |
| SMILES | CC#CC(=O)N(C)[C@H]1C[C@H](F)CN(c2c(F)cc(C(N)=O)c3[nH]c(C)c(Cl)c23)C1 |
| InChI | InChI=1S/C20H21ClF2N4O2/c1-4-5-15(28)26(3)12-6-11(22)8-27(9-12)19-14(23)7-13(20(24)29)18-16(19)17(21)10(2)25-18/h7,11-12,25H,6,8-9H2,1-3H3,(H2,24,29)/t11-,12-/m0/s1 |
| InChIKey | IRKLUGZQRUCASH-RYUDHWBXSA-N |
| XLogP | 2.77 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|