C20H19ClFN3O2 — CID 164585831
4-[(5S)-5-(but-2-ynoylamino)cyclohexen-1-yl]-3-chloro-5-fluoro-2-methyl-1H-indole-7-carboxamide (PubChem CID 164585831) has the molecular formula C20H19ClFN3O2 and a molecular weight of 387.84 g/mol. Its IUPAC name is 4-[(5S)-5-(but-2-ynoylamino)cyclohexen-1-yl]-3-chloro-5-fluoro-2-methyl-1H-indole-7-carboxamide.
| Compound Name | 4-[(5S)-5-(but-2-ynoylamino)cyclohexen-1-yl]-3-chloro-5-fluoro-2-methyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 164585831 |
| Molecular Formula | C20H19ClFN3O2 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 4-[(5S)-5-(but-2-ynoylamino)cyclohexen-1-yl]-3-chloro-5-fluoro-2-methyl-1H-indole-7-carboxamide |
| SMILES | CC#CC(=O)N[C@H]1CCC=C(c2c(F)cc(C(N)=O)c3[nH]c(C)c(Cl)c23)C1 |
| InChI | InChI=1S/C20H19ClFN3O2/c1-3-5-15(26)25-12-7-4-6-11(8-12)16-14(22)9-13(20(23)27)19-17(16)18(21)10(2)24-19/h6,9,12,24H,4,7-8H2,1-2H3,(H2,23,27)(H,25,26)/t12-/m0/s1 |
| InChIKey | BWBLWGQSHLLRBT-LBPRGKRZSA-N |
| XLogP | 3.44 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|