C20H20ClFN2O — CID 175520307
N-[(1S)-3-(3-chloro-5-fluoro-2,7-dimethyl-1H-indol-4-yl)cyclohex-2-en-1-yl]but-2-ynamide (PubChem CID 175520307) has the molecular formula C20H20ClFN2O and a molecular weight of 358.84 g/mol. Its IUPAC name is N-[(1S)-3-(3-chloro-5-fluoro-2,7-dimethyl-1H-indol-4-yl)cyclohex-2-en-1-yl]but-2-ynamide.
| Compound Name | N-[(1S)-3-(3-chloro-5-fluoro-2,7-dimethyl-1H-indol-4-yl)cyclohex-2-en-1-yl]but-2-ynamide |
|---|---|
| PubChem CID | 175520307 |
| Molecular Formula | C20H20ClFN2O |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[(1S)-3-(3-chloro-5-fluoro-2,7-dimethyl-1H-indol-4-yl)cyclohex-2-en-1-yl]but-2-ynamide |
| SMILES | CC#CC(=O)N[C@@H]1C=C(c2c(F)cc(C)c3[nH]c(C)c(Cl)c23)CCC1 |
| InChI | InChI=1S/C20H20ClFN2O/c1-4-6-16(25)24-14-8-5-7-13(10-14)17-15(22)9-11(2)20-18(17)19(21)12(3)23-20/h9-10,14,23H,5,7-8H2,1-3H3,(H,24,25)/t14-/m0/s1 |
| InChIKey | FUUUKIJSMYAXGA-AWEZNQCLSA-N |
| XLogP | 4.65 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|