C21H22ClFN4O2 — CID 168842100
4-[(4aR,7aR)-1-but-2-ynoyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-chloro-5-fluoro-2-methyl-1H-indole-7-carboxamide (PubChem CID 168842100) has the molecular formula C21H22ClFN4O2 and a molecular weight of 416.88 g/mol. Its IUPAC name is 4-[(4aR,7aR)-1-but-2-ynoyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-chloro-5-fluoro-2-methyl-1H-indole-7-carboxamide.
| Compound Name | 4-[(4aR,7aR)-1-but-2-ynoyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-chloro-5-fluoro-2-methyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 168842100 |
| Molecular Formula | C21H22ClFN4O2 |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 4-[(4aR,7aR)-1-but-2-ynoyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-chloro-5-fluoro-2-methyl-1H-indole-7-carboxamide |
| SMILES | CC#CC(=O)N1CCC[C@@H]2CN(c3c(F)cc(C(N)=O)c4[nH]c(C)c(Cl)c34)C[C@@H]21 |
| InChI | InChI=1S/C21H22ClFN4O2/c1-3-5-16(28)27-7-4-6-12-9-26(10-15(12)27)20-14(23)8-13(21(24)29)19-17(20)18(22)11(2)25-19/h8,12,15,25H,4,6-7,9-10H2,1-2H3,(H2,24,29)/t12-,15+/m1/s1 |
| InChIKey | CBDJKKMGVZGZNT-DOMZBBRYSA-N |
| XLogP | 2.82 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|