C22H26FN3O2 — CID 164585770
4-[(3S)-3-[(but-2-ynoylamino)methyl]cyclohexyl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide (PubChem CID 164585770) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-[(3S)-3-[(but-2-ynoylamino)methyl]cyclohexyl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide.
| Compound Name | 4-[(3S)-3-[(but-2-ynoylamino)methyl]cyclohexyl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 164585770 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-[(3S)-3-[(but-2-ynoylamino)methyl]cyclohexyl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide |
| SMILES | CC#CC(=O)NC[C@H]1CCCC(c2c(F)cc(C(N)=O)c3[nH]c(C)c(C)c23)C1 |
| InChI | InChI=1S/C22H26FN3O2/c1-4-6-18(27)25-11-14-7-5-8-15(9-14)20-17(23)10-16(22(24)28)21-19(20)12(2)13(3)26-21/h10,14-15,26H,5,7-9,11H2,1-3H3,(H2,24,28)(H,25,27)/t14-,15?/m0/s1 |
| InChIKey | DCUIJAXAXAXLKC-MLCCFXAWSA-N |
| XLogP | 3.44 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|