C20H23FN4O3 — CID 153325325
[[4-[(3S)-3-aminopiperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carbonyl]amino] but-2-ynoate (PubChem CID 153325325) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is [[4-[(3S)-3-aminopiperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carbonyl]amino] but-2-ynoate.
| Compound Name | [[4-[(3S)-3-aminopiperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carbonyl]amino] but-2-ynoate |
|---|---|
| PubChem CID | 153325325 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | [[4-[(3S)-3-aminopiperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carbonyl]amino] but-2-ynoate |
| SMILES | CC#CC(=O)ONC(=O)c1cc(F)c(N2CCC[C@H](N)C2)c2c(C)c(C)[nH]c12 |
| InChI | InChI=1S/C20H23FN4O3/c1-4-6-16(26)28-24-20(27)14-9-15(21)19(25-8-5-7-13(22)10-25)17-11(2)12(3)23-18(14)17/h9,13,23H,5,7-8,10,22H2,1-3H3,(H,24,27)/t13-/m0/s1 |
| InChIKey | QNEBUGUIPJXESQ-ZDUSSCGKSA-N |
| XLogP | 2.06 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|