C15H13F6N3O3S — CID 121294965
1-methyl-N-(2,3,4-trifluorophenyl)-4-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]pyrrole-2-carboxamide (PubChem CID 121294965) has the molecular formula C15H13F6N3O3S and a molecular weight of 429.34 g/mol. Its IUPAC name is 1-methyl-N-(2,3,4-trifluorophenyl)-4-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]pyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-(2,3,4-trifluorophenyl)-4-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 121294965 |
| Molecular Formula | C15H13F6N3O3S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 1-methyl-N-(2,3,4-trifluorophenyl)-4-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]pyrrole-2-carboxamide |
| SMILES | C[C@H](NS(=O)(=O)c1cc(C(=O)Nc2ccc(F)c(F)c2F)n(C)c1)C(F)(F)F |
| InChI | InChI=1S/C15H13F6N3O3S/c1-7(15(19,20)21)23-28(26,27)8-5-11(24(2)6-8)14(25)22-10-4-3-9(16)12(17)13(10)18/h3-7,23H,1-2H3,(H,22,25)/t7-/m0/s1 |
| InChIKey | ZRKYDPKYWDWOIK-ZETCQYMHSA-N |
| XLogP | 2.92 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|