C17H12F4N4O3S — CID 159446291
N-(3-cyano-2-fluorophenyl)-1-methyl-4-[[(2R)-1,1,1-trifluorobut-3-yn-2-yl]sulfamoyl]pyrrole-2-carboxamide (PubChem CID 159446291) has the molecular formula C17H12F4N4O3S and a molecular weight of 428.37 g/mol. Its IUPAC name is N-(3-cyano-2-fluorophenyl)-1-methyl-4-[[(2R)-1,1,1-trifluorobut-3-yn-2-yl]sulfamoyl]pyrrole-2-carboxamide.
| Compound Name | N-(3-cyano-2-fluorophenyl)-1-methyl-4-[[(2R)-1,1,1-trifluorobut-3-yn-2-yl]sulfamoyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 159446291 |
| Molecular Formula | C17H12F4N4O3S |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-(3-cyano-2-fluorophenyl)-1-methyl-4-[[(2R)-1,1,1-trifluorobut-3-yn-2-yl]sulfamoyl]pyrrole-2-carboxamide |
| SMILES | C#C[C@@H](NS(=O)(=O)c1cc(C(=O)Nc2cccc(C#N)c2F)n(C)c1)C(F)(F)F |
| InChI | InChI=1S/C17H12F4N4O3S/c1-3-14(17(19,20)21)24-29(27,28)11-7-13(25(2)9-11)16(26)23-12-6-4-5-10(8-22)15(12)18/h1,4-7,9,14,24H,2H3,(H,23,26)/t14-/m1/s1 |
| InChIKey | LSUMPHJCRGEEEC-CQSZACIVSA-N |
| XLogP | 2.13 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|