C35H26N2O — CID 121297434
6-(9,9-dimethylxanthen-2-yl)-9-(4-methylphenyl)carbazole-3-carbonitrile (PubChem CID 121297434) has the molecular formula C35H26N2O and a molecular weight of 490.61 g/mol. Its IUPAC name is 6-(9,9-dimethylxanthen-2-yl)-9-(4-methylphenyl)carbazole-3-carbonitrile.
| Compound Name | 6-(9,9-dimethylxanthen-2-yl)-9-(4-methylphenyl)carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 121297434 |
| Molecular Formula | C35H26N2O |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 6-(9,9-dimethylxanthen-2-yl)-9-(4-methylphenyl)carbazole-3-carbonitrile |
| SMILES | Cc1ccc(-n2c3ccc(C#N)cc3c3cc(-c4ccc5c(c4)C(C)(C)c4ccccc4O5)ccc32)cc1 |
| InChI | InChI=1S/C35H26N2O/c1-22-8-13-26(14-9-22)37-31-15-10-23(21-36)18-27(31)28-19-24(11-16-32(28)37)25-12-17-34-30(20-25)35(2,3)29-6-4-5-7-33(29)38-34/h4-20H,1-3H3 |
| InChIKey | MXENZCJGHOQTNE-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |