C56H40O9 — CID 121297880
[4-[2-[1-[2-[2-oxo-2-[4-[(4-prop-2-enoyloxyphenyl)methoxy]phenyl]ethyl]naphthalen-1-yl]naphthalen-2-yl]acetyl]phenyl] 4-prop-2-enoyloxybenzoate (PubChem CID 121297880) has the molecular formula C56H40O9 and a molecular weight of 856.93 g/mol. Its IUPAC name is [4-[2-[1-[2-[2-oxo-2-[4-[(4-prop-2-enoyloxyphenyl)methoxy]phenyl]ethyl]naphthalen-1-yl]naphthalen-2-yl]acetyl]phenyl] 4-prop-2-enoyloxybenzoate.
| Compound Name | [4-[2-[1-[2-[2-oxo-2-[4-[(4-prop-2-enoyloxyphenyl)methoxy]phenyl]ethyl]naphthalen-1-yl]naphthalen-2-yl]acetyl]phenyl] 4-prop-2-enoyloxybenzoate |
|---|---|
| PubChem CID | 121297880 |
| Molecular Formula | C56H40O9 |
| Molecular Weight | 856.93 g/mol |
| Exact Mass | 856.27 |
| IUPAC Name | [4-[2-[1-[2-[2-oxo-2-[4-[(4-prop-2-enoyloxyphenyl)methoxy]phenyl]ethyl]naphthalen-1-yl]naphthalen-2-yl]acetyl]phenyl] 4-prop-2-enoyloxybenzoate |
| SMILES | C=CC(=O)Oc1ccc(COc2ccc(C(=O)Cc3ccc4ccccc4c3-c3c(CC(=O)c4ccc(OC(=O)c5ccc(OC(=O)C=C)cc5)cc4)ccc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C56H40O9/c1-3-52(59)63-45-25-13-36(14-26-45)35-62-44-27-19-39(20-28-44)50(57)33-42-17-15-37-9-5-7-11-48(37)54(42)55-43(18-16-38-10-6-8-12-49(38)55)34-51(58)40-21-29-47(30-22-40)65-56(61)41-23-31-46(32-24-41)64-53(60)4-2/h3-32H,1-2,33-35H2 |
| InChIKey | UYEYGMUNGGVSLC-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.93 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|