C56H38O10 — CID 121297877
[4-[2-[1-[2-[2-oxo-2-[4-(4-prop-2-enoyloxybenzoyl)oxyphenyl]ethyl]naphthalen-1-yl]naphthalen-2-yl]acetyl]phenyl] 4-prop-2-enoyloxybenzoate (PubChem CID 121297877) has the molecular formula C56H38O10 and a molecular weight of 870.91 g/mol. Its IUPAC name is [4-[2-[1-[2-[2-oxo-2-[4-(4-prop-2-enoyloxybenzoyl)oxyphenyl]ethyl]naphthalen-1-yl]naphthalen-2-yl]acetyl]phenyl] 4-prop-2-enoyloxybenzoate.
| Compound Name | [4-[2-[1-[2-[2-oxo-2-[4-(4-prop-2-enoyloxybenzoyl)oxyphenyl]ethyl]naphthalen-1-yl]naphthalen-2-yl]acetyl]phenyl] 4-prop-2-enoyloxybenzoate |
|---|---|
| PubChem CID | 121297877 |
| Molecular Formula | C56H38O10 |
| Molecular Weight | 870.91 g/mol |
| Exact Mass | 870.25 |
| IUPAC Name | [4-[2-[1-[2-[2-oxo-2-[4-(4-prop-2-enoyloxybenzoyl)oxyphenyl]ethyl]naphthalen-1-yl]naphthalen-2-yl]acetyl]phenyl] 4-prop-2-enoyloxybenzoate |
| SMILES | C=CC(=O)Oc1ccc(C(=O)Oc2ccc(C(=O)Cc3ccc4ccccc4c3-c3c(CC(=O)c4ccc(OC(=O)c5ccc(OC(=O)C=C)cc5)cc4)ccc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C56H38O10/c1-3-51(59)63-43-29-21-39(22-30-43)55(61)65-45-25-17-37(18-26-45)49(57)33-41-15-13-35-9-5-7-11-47(35)53(41)54-42(16-14-36-10-6-8-12-48(36)54)34-50(58)38-19-27-46(28-20-38)66-56(62)40-23-31-44(32-24-40)64-52(60)4-2/h3-32H,1-2,33-34H2 |
| InChIKey | VJBQQFWLDLMLRQ-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.91 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|