C54H38O8 — CID 164766803
[4-[(Z)-3-[1-[2-[(Z)-3-[4-(4-methoxybenzoyl)oxyphenyl]-3-oxoprop-1-enyl]naphthalen-1-yl]naphthalen-2-yl]prop-2-enoyl]phenyl] 4-methoxybenzoate (PubChem CID 164766803) has the molecular formula C54H38O8 and a molecular weight of 814.89 g/mol. Its IUPAC name is [4-[(Z)-3-[1-[2-[(Z)-3-[4-(4-methoxybenzoyl)oxyphenyl]-3-oxoprop-1-enyl]naphthalen-1-yl]naphthalen-2-yl]prop-2-enoyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[(Z)-3-[1-[2-[(Z)-3-[4-(4-methoxybenzoyl)oxyphenyl]-3-oxoprop-1-enyl]naphthalen-1-yl]naphthalen-2-yl]prop-2-enoyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 164766803 |
| Molecular Formula | C54H38O8 |
| Molecular Weight | 814.89 g/mol |
| Exact Mass | 814.26 |
| IUPAC Name | [4-[(Z)-3-[1-[2-[(Z)-3-[4-(4-methoxybenzoyl)oxyphenyl]-3-oxoprop-1-enyl]naphthalen-1-yl]naphthalen-2-yl]prop-2-enoyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C(=O)/C=C\c3ccc4ccccc4c3-c3c(/C=C\C(=O)c4ccc(OC(=O)c5ccc(OC)cc5)cc4)ccc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C54H38O8/c1-59-43-25-19-41(20-26-43)53(57)61-45-29-15-37(16-30-45)49(55)33-23-39-13-11-35-7-3-5-9-47(35)51(39)52-40(14-12-36-8-4-6-10-48(36)52)24-34-50(56)38-17-31-46(32-18-38)62-54(58)42-21-27-44(60-2)28-22-42/h3-34H,1-2H3/b33-23-,34-24- |
| InChIKey | DXTDRWRIOXEIPC-DQWRGTGXSA-N |
| XLogP | 11.91 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.89 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|