C52H38O6 — CID 162498616
[3-[(E)-2-[1-[2-[(E)-2-[3-(4-methoxybenzoyl)oxyphenyl]ethenyl]naphthalen-1-yl]naphthalen-2-yl]ethenyl]phenyl] 4-methoxybenzoate (PubChem CID 162498616) has the molecular formula C52H38O6 and a molecular weight of 758.87 g/mol. Its IUPAC name is [3-[(E)-2-[1-[2-[(E)-2-[3-(4-methoxybenzoyl)oxyphenyl]ethenyl]naphthalen-1-yl]naphthalen-2-yl]ethenyl]phenyl] 4-methoxybenzoate.
| Compound Name | [3-[(E)-2-[1-[2-[(E)-2-[3-(4-methoxybenzoyl)oxyphenyl]ethenyl]naphthalen-1-yl]naphthalen-2-yl]ethenyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 162498616 |
| Molecular Formula | C52H38O6 |
| Molecular Weight | 758.87 g/mol |
| Exact Mass | 758.27 |
| IUPAC Name | [3-[(E)-2-[1-[2-[(E)-2-[3-(4-methoxybenzoyl)oxyphenyl]ethenyl]naphthalen-1-yl]naphthalen-2-yl]ethenyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2cccc(/C=C/c3ccc4ccccc4c3-c3c(/C=C/c4cccc(OC(=O)c5ccc(OC)cc5)c4)ccc4ccccc34)c2)cc1 |
| InChI | InChI=1S/C52H38O6/c1-55-43-29-25-41(26-30-43)51(53)57-45-13-7-9-35(33-45)17-19-39-23-21-37-11-3-5-15-47(37)49(39)50-40(24-22-38-12-4-6-16-48(38)50)20-18-36-10-8-14-46(34-36)58-52(54)42-27-31-44(56-2)32-28-42/h3-34H,1-2H3/b19-17+,20-18+ |
| InChIKey | SYGMFCMIECDROZ-XPWSMXQVSA-N |
| XLogP | 12.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.87 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|