About 2-methyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole
2-methyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole (PubChem CID 121299725) has the molecular formula C7H13NS
and a molecular weight of 143.25 g/mol. Its IUPAC name is 2-methyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole.
Analyze 2-methyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole?
The IUPAC name of 2-methyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole (CID 121299725) is 2-methyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole.
What is the SMILES notation for 2-methyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole?
The canonical SMILES for 2-methyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole is CC1NC(C(C)C)=CS1.
What is the InChIKey of 2-methyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole?
The InChIKey is KBGJIHVSXGLLAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NS/c1-5(2)7-4-9-6(3)8-7/h4-6,8H,1-3H3.
What are the key properties of 2-methyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole?
2-methyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole has a molecular weight of 143.25 g/mol, XLogP of 2.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole is sourced from PubChem (CID 121299725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).