C14H18F2N4O4S — CID 121303911
4-(4,4-difluoropiperidine-1-carbonyl)-N'-(2-hydroxy-2-methylpropanoyl)-1,3-thiazole-2-carbohydrazide (PubChem CID 121303911) has the molecular formula C14H18F2N4O4S and a molecular weight of 376.39 g/mol. Its IUPAC name is 4-(4,4-difluoropiperidine-1-carbonyl)-N'-(2-hydroxy-2-methylpropanoyl)-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-(4,4-difluoropiperidine-1-carbonyl)-N'-(2-hydroxy-2-methylpropanoyl)-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 121303911 |
| Molecular Formula | C14H18F2N4O4S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 4-(4,4-difluoropiperidine-1-carbonyl)-N'-(2-hydroxy-2-methylpropanoyl)-1,3-thiazole-2-carbohydrazide |
| SMILES | CC(C)(O)C(=O)NNC(=O)c1nc(C(=O)N2CCC(F)(F)CC2)cs1 |
| InChI | InChI=1S/C14H18F2N4O4S/c1-13(2,24)12(23)19-18-9(21)10-17-8(7-25-10)11(22)20-5-3-14(15,16)4-6-20/h7,24H,3-6H2,1-2H3,(H,18,21)(H,19,23) |
| InChIKey | YBGBGNNBCZGXEF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|