C6H13NOS — CID 121305464
1-(3-methyl-1,3-thiazolidin-2-yl)ethanol (PubChem CID 121305464) has the molecular formula C6H13NOS and a molecular weight of 147.24 g/mol. Its IUPAC name is 1-(3-methyl-1,3-thiazolidin-2-yl)ethanol.
| Compound Name | 1-(3-methyl-1,3-thiazolidin-2-yl)ethanol |
|---|---|
| PubChem CID | 121305464 |
| Molecular Formula | C6H13NOS |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1-(3-methyl-1,3-thiazolidin-2-yl)ethanol |
| SMILES | CC(O)C1SCCN1C |
| InChI | InChI=1S/C6H13NOS/c1-5(8)6-7(2)3-4-9-6/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | WZJKFCXZFNVDFD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |