C22H23F3N2O6 — CID 121305562
2-[benzyl-[2-[carboxymethyl-[[2-(2,2,2-trifluoroacetyl)oxyphenyl]methyl]amino]ethyl]amino]acetic acid (PubChem CID 121305562) has the molecular formula C22H23F3N2O6 and a molecular weight of 468.43 g/mol. Its IUPAC name is 2-[benzyl-[2-[carboxymethyl-[[2-(2,2,2-trifluoroacetyl)oxyphenyl]methyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[benzyl-[2-[carboxymethyl-[[2-(2,2,2-trifluoroacetyl)oxyphenyl]methyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 121305562 |
| Molecular Formula | C22H23F3N2O6 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-[benzyl-[2-[carboxymethyl-[[2-(2,2,2-trifluoroacetyl)oxyphenyl]methyl]amino]ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)Cc1ccccc1OC(=O)C(F)(F)F)Cc1ccccc1 |
| InChI | InChI=1S/C22H23F3N2O6/c23-22(24,25)21(32)33-18-9-5-4-8-17(18)13-27(15-20(30)31)11-10-26(14-19(28)29)12-16-6-2-1-3-7-16/h1-9H,10-15H2,(H,28,29)(H,30,31) |
| InChIKey | HYVISDRCFBWUIX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|