C26H17N3O — CID 121307130
[3-([1]benzofuro[3,2-c]carbazol-5-yl)-5-methanimidoylphenyl]methanimine (PubChem CID 121307130) has the molecular formula C26H17N3O and a molecular weight of 387.44 g/mol. Its IUPAC name is [3-([1]benzofuro[3,2-c]carbazol-5-yl)-5-methanimidoylphenyl]methanimine.
| Compound Name | [3-([1]benzofuro[3,2-c]carbazol-5-yl)-5-methanimidoylphenyl]methanimine |
|---|---|
| PubChem CID | 121307130 |
| Molecular Formula | C26H17N3O |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | [3-([1]benzofuro[3,2-c]carbazol-5-yl)-5-methanimidoylphenyl]methanimine |
| SMILES | [H]/N=C/c1cc(/C=N/[H])cc(-n2c3ccccc3c3c4oc5ccccc5c4ccc32)c1 |
| InChI | InChI=1S/C26H17N3O/c27-14-16-11-17(15-28)13-18(12-16)29-22-7-3-1-6-21(22)25-23(29)10-9-20-19-5-2-4-8-24(19)30-26(20)25/h1-15,27-28H/b27-14+,28-15+ |
| InChIKey | CVUAGBBZEMBOAL-VNRWOIRSSA-N |
| XLogP | 6.68 |
| TPSA | 65.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|