C32H21N3O — CID 121307442
[4-methanimidoyl-3-(2-phenyl-[1]benzofuro[3,2-c]carbazol-5-yl)phenyl]methanimine (PubChem CID 121307442) has the molecular formula C32H21N3O and a molecular weight of 463.54 g/mol. Its IUPAC name is [4-methanimidoyl-3-(2-phenyl-[1]benzofuro[3,2-c]carbazol-5-yl)phenyl]methanimine.
| Compound Name | [4-methanimidoyl-3-(2-phenyl-[1]benzofuro[3,2-c]carbazol-5-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 121307442 |
| Molecular Formula | C32H21N3O |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [4-methanimidoyl-3-(2-phenyl-[1]benzofuro[3,2-c]carbazol-5-yl)phenyl]methanimine |
| SMILES | [H]/N=C\c1ccc(/C=N/[H])cc1-n1c2ccc(-c3ccccc3)cc2c2c3oc4ccccc4c3ccc21 |
| InChI | InChI=1S/C32H21N3O/c33-18-20-10-11-23(19-34)29(16-20)35-27-14-12-22(21-6-2-1-3-7-21)17-26(27)31-28(35)15-13-25-24-8-4-5-9-30(24)36-32(25)31/h1-19,33-34H/b33-18+,34-19- |
| InChIKey | CNDQGWQNCLWDKA-PKUOHODXSA-N |
| XLogP | 8.35 |
| TPSA | 65.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|