C40H26N4 — CID 121307476
[5-(12-azapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-12-yl)-2-carbazol-9-yl-3-methanimidoylphenyl]methanimine (PubChem CID 121307476) has the molecular formula C40H26N4 and a molecular weight of 562.68 g/mol. Its IUPAC name is [5-(12-azapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-12-yl)-2-carbazol-9-yl-3-methanimidoylphenyl]methanimine.
| Compound Name | [5-(12-azapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-12-yl)-2-carbazol-9-yl-3-methanimidoylphenyl]methanimine |
|---|---|
| PubChem CID | 121307476 |
| Molecular Formula | C40H26N4 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | [5-(12-azapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-12-yl)-2-carbazol-9-yl-3-methanimidoylphenyl]methanimine |
| SMILES | [H]/N=C/c1cc(-n2c3ccc4ccccc4c3c3c4ccccc4ccc32)cc(/C=N/[H])c1-n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C40H26N4/c41-23-27-21-29(22-28(24-42)40(27)44-34-15-7-5-13-32(34)33-14-6-8-16-35(33)44)43-36-19-17-25-9-1-3-11-30(25)38(36)39-31-12-4-2-10-26(31)18-20-37(39)43/h1-24,41-42H/b41-23+,42-24+ |
| InChIKey | FAQHNZXAYUGYBZ-WAJJMWJGSA-N |
| XLogP | 10.18 |
| TPSA | 57.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|