C64H44N6 — CID 121307247
7-[3,5-dimethanimidoyl-2-[10-(N-phenylanilino)benzo[c]carbazol-7-yl]phenyl]-N,N-diphenylbenzo[c]carbazol-10-amine (PubChem CID 121307247) has the molecular formula C64H44N6 and a molecular weight of 897.10 g/mol. Its IUPAC name is 7-[3,5-dimethanimidoyl-2-[10-(N-phenylanilino)benzo[c]carbazol-7-yl]phenyl]-N,N-diphenylbenzo[c]carbazol-10-amine.
| Compound Name | 7-[3,5-dimethanimidoyl-2-[10-(N-phenylanilino)benzo[c]carbazol-7-yl]phenyl]-N,N-diphenylbenzo[c]carbazol-10-amine |
|---|---|
| PubChem CID | 121307247 |
| Molecular Formula | C64H44N6 |
| Molecular Weight | 897.10 g/mol |
| Exact Mass | 896.36 |
| IUPAC Name | 7-[3,5-dimethanimidoyl-2-[10-(N-phenylanilino)benzo[c]carbazol-7-yl]phenyl]-N,N-diphenylbenzo[c]carbazol-10-amine |
| SMILES | [H]/N=C/c1cc(/C=N/[H])c(-n2c3ccc(N(c4ccccc4)c4ccccc4)cc3c3c4ccccc4ccc32)c(-n2c3ccc(N(c4ccccc4)c4ccccc4)cc3c3c4ccccc4ccc32)c1 |
| InChI | InChI=1S/C64H44N6/c65-41-43-37-46(42-66)64(70-58-36-32-52(68(49-23-9-3-10-24-49)50-25-11-4-12-26-50)40-56(58)63-54-28-16-14-18-45(54)30-34-60(63)70)61(38-43)69-57-35-31-51(67(47-19-5-1-6-20-47)48-21-7-2-8-22-48)39-55(57)62-53-27-15-13-17-44(53)29-33-59(62)69/h1-42,65-66H/b65-41+,66-42+ |
| InChIKey | FLWTWFKAFCIXHX-DFIWAFBMSA-N |
| XLogP | 17.12 |
| TPSA | 64.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.10 |
| LogP ≤ 5 | 17.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|