C36H22N4 — CID 153462466
7-(3,5-diisocyanophenyl)-N,N-diphenylbenzo[c]carbazol-10-amine (PubChem CID 153462466) has the molecular formula C36H22N4 and a molecular weight of 510.60 g/mol. Its IUPAC name is 7-(3,5-diisocyanophenyl)-N,N-diphenylbenzo[c]carbazol-10-amine.
| Compound Name | 7-(3,5-diisocyanophenyl)-N,N-diphenylbenzo[c]carbazol-10-amine |
|---|---|
| PubChem CID | 153462466 |
| Molecular Formula | C36H22N4 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 7-(3,5-diisocyanophenyl)-N,N-diphenylbenzo[c]carbazol-10-amine |
| SMILES | [C-]#[N+]c1cc([N+]#[C-])cc(-n2c3ccc(N(c4ccccc4)c4ccccc4)cc3c3c4ccccc4ccc32)c1 |
| InChI | InChI=1S/C36H22N4/c1-37-26-21-27(38-2)23-31(22-26)40-34-20-18-30(39(28-12-5-3-6-13-28)29-14-7-4-8-15-29)24-33(34)36-32-16-10-9-11-25(32)17-19-35(36)40/h3-24H |
| InChIKey | XTRPDVSBEZVELG-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 16.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|