C44H26N4 — CID 123997757
N,N-bis(4-isocyanophenyl)-3-phenyl-3-azahexacyclo[15.8.0.02,10.04,9.011,16.020,25]pentacosa-1(17),2(10),4(9),5,7,11,13,15,18,20,22,24-dodecaen-7-amine (PubChem CID 123997757) has the molecular formula C44H26N4 and a molecular weight of 610.72 g/mol. Its IUPAC name is N,N-bis(4-isocyanophenyl)-3-phenyl-3-azahexacyclo[15.8.0.02,10.04,9.011,16.020,25]pentacosa-1(17),2(10),4(9),5,7,11,13,15,18,20,22,24-dodecaen-7-amine.
| Compound Name | N,N-bis(4-isocyanophenyl)-3-phenyl-3-azahexacyclo[15.8.0.02,10.04,9.011,16.020,25]pentacosa-1(17),2(10),4(9),5,7,11,13,15,18,20,22,24-dodecaen-7-amine |
|---|---|
| PubChem CID | 123997757 |
| Molecular Formula | C44H26N4 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | N,N-bis(4-isocyanophenyl)-3-phenyl-3-azahexacyclo[15.8.0.02,10.04,9.011,16.020,25]pentacosa-1(17),2(10),4(9),5,7,11,13,15,18,20,22,24-dodecaen-7-amine |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc([N+]#[C-])cc2)c2ccc3c(c2)c2c4ccccc4c4ccc5ccccc5c4c2n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C44H26N4/c1-45-30-17-21-33(22-18-30)47(34-23-19-31(46-2)20-24-34)35-25-27-41-40(28-35)43-38-15-9-8-14-37(38)39-26-16-29-10-6-7-13-36(29)42(39)44(43)48(41)32-11-4-3-5-12-32/h3-28H |
| InChIKey | XGMUFURSDXDYDG-UHFFFAOYSA-N |
| XLogP | 12.81 |
| TPSA | 16.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|