C17H9F2NO3 — CID 121307847
3-(6,8-difluoro-7-hydroxy-4-methyl-2-oxochromen-3-yl)benzonitrile (PubChem CID 121307847) has the molecular formula C17H9F2NO3 and a molecular weight of 313.26 g/mol. Its IUPAC name is 3-(6,8-difluoro-7-hydroxy-4-methyl-2-oxochromen-3-yl)benzonitrile.
| Compound Name | 3-(6,8-difluoro-7-hydroxy-4-methyl-2-oxochromen-3-yl)benzonitrile |
|---|---|
| PubChem CID | 121307847 |
| Molecular Formula | C17H9F2NO3 |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3-(6,8-difluoro-7-hydroxy-4-methyl-2-oxochromen-3-yl)benzonitrile |
| SMILES | Cc1c(-c2cccc(C#N)c2)c(=O)oc2c(F)c(O)c(F)cc12 |
| InChI | InChI=1S/C17H9F2NO3/c1-8-11-6-12(18)15(21)14(19)16(11)23-17(22)13(8)10-4-2-3-9(5-10)7-20/h2-6,21H,1H3 |
| InChIKey | NSOBDMRZUIUZQK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|