C22H38N2O6 — CID 121308582
tert-butyl 2-[(2S)-1,3-dibutoxy-1-oxopropan-2-yl]-3-oxo-2,5-diazaspiro[3.4]octane-5-carboxylate (PubChem CID 121308582) has the molecular formula C22H38N2O6 and a molecular weight of 426.55 g/mol. Its IUPAC name is tert-butyl 2-[(2S)-1,3-dibutoxy-1-oxopropan-2-yl]-3-oxo-2,5-diazaspiro[3.4]octane-5-carboxylate.
| Compound Name | tert-butyl 2-[(2S)-1,3-dibutoxy-1-oxopropan-2-yl]-3-oxo-2,5-diazaspiro[3.4]octane-5-carboxylate |
|---|---|
| PubChem CID | 121308582 |
| Molecular Formula | C22H38N2O6 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | tert-butyl 2-[(2S)-1,3-dibutoxy-1-oxopropan-2-yl]-3-oxo-2,5-diazaspiro[3.4]octane-5-carboxylate |
| SMILES | CCCCOC[C@@H](C(=O)OCCCC)N1CC2(CCCN2C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C22H38N2O6/c1-6-8-13-28-15-17(18(25)29-14-9-7-2)23-16-22(19(23)26)11-10-12-24(22)20(27)30-21(3,4)5/h17H,6-16H2,1-5H3/t17-,22?/m0/s1 |
| InChIKey | OLMDFOIEFDFSAX-LBOXEOMUSA-N |
| XLogP | 3.13 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|