C22H15ClN4O2S — CID 1213092
2-chloro-N-[(4-oxo-2-phenylquinazolin-3-yl)carbamothioyl]benzamide (PubChem CID 1213092) has the molecular formula C22H15ClN4O2S and a molecular weight of 434.91 g/mol. Its IUPAC name is 2-chloro-N-[(4-oxo-2-phenylquinazolin-3-yl)carbamothioyl]benzamide.
| Compound Name | 2-chloro-N-[(4-oxo-2-phenylquinazolin-3-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1213092 |
| Molecular Formula | C22H15ClN4O2S |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 2-chloro-N-[(4-oxo-2-phenylquinazolin-3-yl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nn1c(-c2ccccc2)nc2ccccc2c1=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H15ClN4O2S/c23-17-12-6-4-10-15(17)20(28)25-22(30)26-27-19(14-8-2-1-3-9-14)24-18-13-7-5-11-16(18)21(27)29/h1-13H,(H2,25,26,28,30) |
| InChIKey | WYQGSKHGRAGIQI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|