C10H8ClN5OS — CID 2374505
2-chloro-N-(1,2,4-triazol-4-ylcarbamothioyl)benzamide (PubChem CID 2374505) has the molecular formula C10H8ClN5OS and a molecular weight of 281.73 g/mol. Its IUPAC name is 2-chloro-N-(1,2,4-triazol-4-ylcarbamothioyl)benzamide.
| Compound Name | 2-chloro-N-(1,2,4-triazol-4-ylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 2374505 |
| Molecular Formula | C10H8ClN5OS |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 2-chloro-N-(1,2,4-triazol-4-ylcarbamothioyl)benzamide |
| SMILES | O=C(NC(=S)Nn1cnnc1)c1ccccc1Cl |
| InChI | InChI=1S/C10H8ClN5OS/c11-8-4-2-1-3-7(8)9(17)14-10(18)15-16-5-12-13-6-16/h1-6H,(H2,14,15,17,18) |
| InChIKey | UIPRUDPMZMYSHK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|