C13H13Cl3N6O2S — CID 1113291
2-methoxy-N-[(1R)-2,2,2-trichloro-1-(1,2,4-triazol-4-ylcarbamothioylamino)ethyl]benzamide (PubChem CID 1113291) has the molecular formula C13H13Cl3N6O2S and a molecular weight of 423.71 g/mol. Its IUPAC name is 2-methoxy-N-[(1R)-2,2,2-trichloro-1-(1,2,4-triazol-4-ylcarbamothioylamino)ethyl]benzamide.
| Compound Name | 2-methoxy-N-[(1R)-2,2,2-trichloro-1-(1,2,4-triazol-4-ylcarbamothioylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 1113291 |
| Molecular Formula | C13H13Cl3N6O2S |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 2-methoxy-N-[(1R)-2,2,2-trichloro-1-(1,2,4-triazol-4-ylcarbamothioylamino)ethyl]benzamide |
| SMILES | COc1ccccc1C(=O)N[C@H](NC(=S)Nn1cnnc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H13Cl3N6O2S/c1-24-9-5-3-2-4-8(9)10(23)19-11(13(14,15)16)20-12(25)21-22-6-17-18-7-22/h2-7,11H,1H3,(H,19,23)(H2,20,21,25)/t11-/m1/s1 |
| InChIKey | GZBLQLXMXWHFNK-LLVKDONJSA-N |
| XLogP | 1.83 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|