C15H22N2O — CID 121312890
(4aR,5S,8aR)-1-benzyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoxalin-5-ol (PubChem CID 121312890) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is (4aR,5S,8aR)-1-benzyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoxalin-5-ol.
| Compound Name | (4aR,5S,8aR)-1-benzyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoxalin-5-ol |
|---|---|
| PubChem CID | 121312890 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (4aR,5S,8aR)-1-benzyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoxalin-5-ol |
| SMILES | O[C@H]1CCC[C@@H]2[C@H]1NCCN2Cc1ccccc1 |
| InChI | InChI=1S/C15H22N2O/c18-14-8-4-7-13-15(14)16-9-10-17(13)11-12-5-2-1-3-6-12/h1-3,5-6,13-16,18H,4,7-11H2/t13-,14+,15-/m1/s1 |
| InChIKey | XCMHURKRKIBTJW-QLFBSQMISA-N |
| XLogP | 1.37 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |