C28H29N5OS — CID 121313619
3-(naphthalen-1-ylmethyl)-7-[(1,3,5-trimethylpyrazol-4-yl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 121313619) has the molecular formula C28H29N5OS and a molecular weight of 483.64 g/mol. Its IUPAC name is 3-(naphthalen-1-ylmethyl)-7-[(1,3,5-trimethylpyrazol-4-yl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(naphthalen-1-ylmethyl)-7-[(1,3,5-trimethylpyrazol-4-yl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 121313619 |
| Molecular Formula | C28H29N5OS |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 3-(naphthalen-1-ylmethyl)-7-[(1,3,5-trimethylpyrazol-4-yl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nn(C)c(C)c1CNC1CCc2c(sc3ncn(Cc4cccc5ccccc45)c(=O)c23)C1 |
| InChI | InChI=1S/C28H29N5OS/c1-17-24(18(2)32(3)31-17)14-29-21-11-12-23-25(13-21)35-27-26(23)28(34)33(16-30-27)15-20-9-6-8-19-7-4-5-10-22(19)20/h4-10,16,21,29H,11-15H2,1-3H3 |
| InChIKey | SUWXFWFRGGGLGI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |