C27H22F2N4OS — CID 30852634
(7S)-7-[(2,6-difluorophenyl)methylamino]-3-(quinolin-3-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 30852634) has the molecular formula C27H22F2N4OS and a molecular weight of 488.56 g/mol. Its IUPAC name is (7S)-7-[(2,6-difluorophenyl)methylamino]-3-(quinolin-3-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7S)-7-[(2,6-difluorophenyl)methylamino]-3-(quinolin-3-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 30852634 |
| Molecular Formula | C27H22F2N4OS |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | (7S)-7-[(2,6-difluorophenyl)methylamino]-3-(quinolin-3-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c3c(sc2ncn1Cc1cnc2ccccc2c1)C[C@@H](NCc1c(F)cccc1F)CC3 |
| InChI | InChI=1S/C27H22F2N4OS/c28-21-5-3-6-22(29)20(21)13-30-18-8-9-19-24(11-18)35-26-25(19)27(34)33(15-32-26)14-16-10-17-4-1-2-7-23(17)31-12-16/h1-7,10,12,15,18,30H,8-9,11,13-14H2/t18-/m0/s1 |
| InChIKey | VYVXJGZUTOWIFA-SFHVURJKSA-N |
| XLogP | 4.98 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |