C23H19F3N4OS — CID 25364965
(7R)-3-(pyridin-4-ylmethyl)-7-[(3,4,5-trifluorophenyl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 25364965) has the molecular formula C23H19F3N4OS and a molecular weight of 456.49 g/mol. Its IUPAC name is (7R)-3-(pyridin-4-ylmethyl)-7-[(3,4,5-trifluorophenyl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7R)-3-(pyridin-4-ylmethyl)-7-[(3,4,5-trifluorophenyl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 25364965 |
| Molecular Formula | C23H19F3N4OS |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | (7R)-3-(pyridin-4-ylmethyl)-7-[(3,4,5-trifluorophenyl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c3c(sc2ncn1Cc1ccncc1)C[C@H](NCc1cc(F)c(F)c(F)c1)CC3 |
| InChI | InChI=1S/C23H19F3N4OS/c24-17-7-14(8-18(25)21(17)26)10-28-15-1-2-16-19(9-15)32-22-20(16)23(31)30(12-29-22)11-13-3-5-27-6-4-13/h3-8,12,15,28H,1-2,9-11H2/t15-/m1/s1 |
| InChIKey | UWAWASSVIGIEAM-OAHLLOKOSA-N |
| XLogP | 3.97 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|