C26H25F2N3O2S — CID 45204051
7-[(3,4-difluorophenyl)methylamino]-3-[2-(2-methoxyphenyl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 45204051) has the molecular formula C26H25F2N3O2S and a molecular weight of 481.57 g/mol. Its IUPAC name is 7-[(3,4-difluorophenyl)methylamino]-3-[2-(2-methoxyphenyl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-[(3,4-difluorophenyl)methylamino]-3-[2-(2-methoxyphenyl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 45204051 |
| Molecular Formula | C26H25F2N3O2S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 7-[(3,4-difluorophenyl)methylamino]-3-[2-(2-methoxyphenyl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccccc1CCn1cnc2sc3c(c2c1=O)CCC(NCc1ccc(F)c(F)c1)C3 |
| InChI | InChI=1S/C26H25F2N3O2S/c1-33-22-5-3-2-4-17(22)10-11-31-15-30-25-24(26(31)32)19-8-7-18(13-23(19)34-25)29-14-16-6-9-20(27)21(28)12-16/h2-6,9,12,15,18,29H,7-8,10-11,13-14H2,1H3 |
| InChIKey | TZJCSXMTGXOLLW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |