About [3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate
[3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate (PubChem CID 121317628) has the molecular formula C16H21ClN2O3S
and a molecular weight of 356.88 g/mol. Its IUPAC name is [3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate.
Molecular Properties
| Compound Name | [3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate |
| PubChem CID | 121317628 |
| Molecular Formula | C16H21ClN2O3S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate |
| SMILES | CC1(C)CCC(OS(C)(=O)=O)CC1Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClN2O3S/c1-16(2)7-6-13(22-23(3,20)21)9-15(16)19-12-5-4-11(10-18)14(17)8-12/h4-5,8,13,15,19H,6-7,9H2,1-3H3 |
| InChIKey | DEBRTNRHLGFHJJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate?
The IUPAC name of [3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate (CID 121317628) is [3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate.
What is the SMILES notation for [3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate?
The canonical SMILES for [3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate is CC1(C)CCC(OS(C)(=O)=O)CC1Nc1ccc(C#N)c(Cl)c1.
What is the InChIKey of [3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate?
The InChIKey is DEBRTNRHLGFHJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClN2O3S/c1-16(2)7-6-13(22-23(3,20)21)9-15(16)19-12-5-4-11(10-18)14(17)8-12/h4-5,8,13,15,19H,6-7,9H2,1-3H3.
What are the key properties of [3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate?
[3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate has a molecular weight of 356.88 g/mol, XLogP of 3.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-chloro-4-cyanoanilino)-4,4-dimethylcyclohexyl] methanesulfonate is sourced from PubChem (CID 121317628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).