C16H16ClN3O — CID 121326512
4-(3-amino-5-chloro-2-methanimidoylphenyl)-N,N-dimethylbenzamide (PubChem CID 121326512) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 4-(3-amino-5-chloro-2-methanimidoylphenyl)-N,N-dimethylbenzamide.
| Compound Name | 4-(3-amino-5-chloro-2-methanimidoylphenyl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 121326512 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-(3-amino-5-chloro-2-methanimidoylphenyl)-N,N-dimethylbenzamide |
| SMILES | [H]/N=C/c1c(N)cc(Cl)cc1-c1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C16H16ClN3O/c1-20(2)16(21)11-5-3-10(4-6-11)13-7-12(17)8-15(19)14(13)9-18/h3-9,18H,19H2,1-2H3/b18-9+ |
| InChIKey | CCTZQFRBIPHNNM-GIJQJNRQSA-N |
| XLogP | 3.29 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|