C11H16N2OS — CID 142936880
4-amino-N,N-dimethylbenzamide;ethanethial (PubChem CID 142936880) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 4-amino-N,N-dimethylbenzamide;ethanethial.
| Compound Name | 4-amino-N,N-dimethylbenzamide;ethanethial |
|---|---|
| PubChem CID | 142936880 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-amino-N,N-dimethylbenzamide;ethanethial |
| SMILES | CC=S.CN(C)C(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C9H12N2O.C2H4S/c1-11(2)9(12)7-3-5-8(10)6-4-7;1-2-3/h3-6H,10H2,1-2H3;2H,1H3 |
| InChIKey | JTJFXNVRJVOEER-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|