C10H13N3O2 — CID 43373883
4-amino-N-(2-amino-2-oxoethyl)-N-methylbenzamide (PubChem CID 43373883) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-amino-N-(2-amino-2-oxoethyl)-N-methylbenzamide.
| Compound Name | 4-amino-N-(2-amino-2-oxoethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 43373883 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 4-amino-N-(2-amino-2-oxoethyl)-N-methylbenzamide |
| SMILES | CN(CC(N)=O)C(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C10H13N3O2/c1-13(6-9(12)14)10(15)7-2-4-8(11)5-3-7/h2-5H,6,11H2,1H3,(H2,12,14) |
| InChIKey | PXCKZOFQIDWNRX-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|