C14H20N4O2S — CID 121326797
4-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)-1H-indazole (PubChem CID 121326797) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 4-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)-1H-indazole.
| Compound Name | 4-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)-1H-indazole |
|---|---|
| PubChem CID | 121326797 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 4-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)-1H-indazole |
| SMILES | CC1(C)CN(c2cccc3[nH]ncc23)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C14H20N4O2S/c1-14(2)10-17(7-8-18(14)21(3,19)20)13-6-4-5-12-11(13)9-15-16-12/h4-6,9H,7-8,10H2,1-3H3,(H,15,16) |
| InChIKey | NTTNGVUPQCGEOP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |