C27H20ClF4N3O8S2 — CID 121333900
4-[5-chloro-4-(3-fluorophenyl)-2-methoxyphenyl]-2-methyl-N-(1,2-oxazol-3-yl)-1-oxoisoquinoline-7-sulfonamide;trifluoromethanesulfonic acid (PubChem CID 121333900) has the molecular formula C27H20ClF4N3O8S2 and a molecular weight of 690.05 g/mol. Its IUPAC name is 4-[5-chloro-4-(3-fluorophenyl)-2-methoxyphenyl]-2-methyl-N-(1,2-oxazol-3-yl)-1-oxoisoquinoline-7-sulfonamide;trifluoromethanesulfonic acid.
| Compound Name | 4-[5-chloro-4-(3-fluorophenyl)-2-methoxyphenyl]-2-methyl-N-(1,2-oxazol-3-yl)-1-oxoisoquinoline-7-sulfonamide;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 121333900 |
| Molecular Formula | C27H20ClF4N3O8S2 |
| Molecular Weight | 690.05 g/mol |
| Exact Mass | 689.03 |
| IUPAC Name | 4-[5-chloro-4-(3-fluorophenyl)-2-methoxyphenyl]-2-methyl-N-(1,2-oxazol-3-yl)-1-oxoisoquinoline-7-sulfonamide;trifluoromethanesulfonic acid |
| SMILES | COc1cc(-c2cccc(F)c2)c(Cl)cc1-c1cn(C)c(=O)c2cc(S(=O)(=O)Nc3ccon3)ccc12.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C26H19ClFN3O5S.CHF3O3S/c1-31-14-22(20-12-23(27)19(13-24(20)35-2)15-4-3-5-16(28)10-15)18-7-6-17(11-21(18)26(31)32)37(33,34)30-25-8-9-36-29-25;2-1(3,4)8(5,6)7/h3-14H,1-2H3,(H,29,30);(H,5,6,7) |
| InChIKey | HNUZXFJSBIJLLY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.05 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|