C23H17ClF3N5O5S — CID 134201231
1-[5-chloro-2-methoxy-4-(3,4,5-trifluorophenyl)phenyl]-3-methyl-1-[5-(1,2-oxazol-3-ylsulfamoyl)-2-pyridinyl]urea (PubChem CID 134201231) has the molecular formula C23H17ClF3N5O5S and a molecular weight of 567.93 g/mol. Its IUPAC name is 1-[5-chloro-2-methoxy-4-(3,4,5-trifluorophenyl)phenyl]-3-methyl-1-[5-(1,2-oxazol-3-ylsulfamoyl)-2-pyridinyl]urea.
| Compound Name | 1-[5-chloro-2-methoxy-4-(3,4,5-trifluorophenyl)phenyl]-3-methyl-1-[5-(1,2-oxazol-3-ylsulfamoyl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 134201231 |
| Molecular Formula | C23H17ClF3N5O5S |
| Molecular Weight | 567.93 g/mol |
| Exact Mass | 567.06 |
| IUPAC Name | 1-[5-chloro-2-methoxy-4-(3,4,5-trifluorophenyl)phenyl]-3-methyl-1-[5-(1,2-oxazol-3-ylsulfamoyl)-2-pyridinyl]urea |
| SMILES | CNC(=O)N(c1ccc(S(=O)(=O)Nc2ccon2)cn1)c1cc(Cl)c(-c2cc(F)c(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C23H17ClF3N5O5S/c1-28-23(33)32(21-4-3-13(11-29-21)38(34,35)31-20-5-6-37-30-20)18-10-15(24)14(9-19(18)36-2)12-7-16(25)22(27)17(26)8-12/h3-11H,1-2H3,(H,28,33)(H,30,31) |
| InChIKey | WHOWXVBOSLJPQY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.93 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|