C31H23ClF9N3O5S — CID 138676861
(2,3,4,5,6-pentafluorophenyl) 6-[N-[tert-butyl(methyl)carbamoyl]-5-chloro-4-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methoxyanilino]pyridine-3-sulfonate (PubChem CID 138676861) has the molecular formula C31H23ClF9N3O5S and a molecular weight of 756.04 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 6-[N-[tert-butyl(methyl)carbamoyl]-5-chloro-4-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methoxyanilino]pyridine-3-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 6-[N-[tert-butyl(methyl)carbamoyl]-5-chloro-4-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methoxyanilino]pyridine-3-sulfonate |
|---|---|
| PubChem CID | 138676861 |
| Molecular Formula | C31H23ClF9N3O5S |
| Molecular Weight | 756.04 g/mol |
| Exact Mass | 755.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 6-[N-[tert-butyl(methyl)carbamoyl]-5-chloro-4-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methoxyanilino]pyridine-3-sulfonate |
| SMILES | COc1cc(-c2ccc(F)c(C(F)(F)F)c2)c(Cl)cc1N(C(=O)N(C)C(C)(C)C)c1ccc(S(=O)(=O)Oc2c(F)c(F)c(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C31H23ClF9N3O5S/c1-30(2,3)43(4)29(45)44(20-12-18(32)16(11-21(20)48-5)14-6-8-19(33)17(10-14)31(39,40)41)22-9-7-15(13-42-22)50(46,47)49-28-26(37)24(35)23(34)25(36)27(28)38/h6-13H,1-5H3 |
| InChIKey | PZNGLBXLAOJVLZ-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.04 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|