About ethyl acetate;4-hydroxy-4-methylpentan-2-one
ethyl acetate;4-hydroxy-4-methylpentan-2-one (PubChem CID 121334075) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is ethyl acetate;4-hydroxy-4-methylpentan-2-one.
Molecular Properties
| Compound Name | ethyl acetate;4-hydroxy-4-methylpentan-2-one |
| PubChem CID | 121334075 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | ethyl acetate;4-hydroxy-4-methylpentan-2-one |
| SMILES | CC(=O)CC(C)(C)O.CCOC(C)=O |
| InChI | InChI=1S/C6H12O2.C4H8O2/c1-5(7)4-6(2,3)8;1-3-6-4(2)5/h8H,4H2,1-3H3;3H2,1-2H3 |
| InChIKey | MOARWRHGGZUCJI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl acetate;4-hydroxy-4-methylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;4-hydroxy-4-methylpentan-2-one?
The IUPAC name of ethyl acetate;4-hydroxy-4-methylpentan-2-one (CID 121334075) is ethyl acetate;4-hydroxy-4-methylpentan-2-one.
What is the SMILES notation for ethyl acetate;4-hydroxy-4-methylpentan-2-one?
The canonical SMILES for ethyl acetate;4-hydroxy-4-methylpentan-2-one is CC(=O)CC(C)(C)O.CCOC(C)=O.
What is the InChIKey of ethyl acetate;4-hydroxy-4-methylpentan-2-one?
The InChIKey is MOARWRHGGZUCJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C4H8O2/c1-5(7)4-6(2,3)8;1-3-6-4(2)5/h8H,4H2,1-3H3;3H2,1-2H3.
What are the key properties of ethyl acetate;4-hydroxy-4-methylpentan-2-one?
ethyl acetate;4-hydroxy-4-methylpentan-2-one has a molecular weight of 204.27 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;4-hydroxy-4-methylpentan-2-one is sourced from PubChem (CID 121334075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).