C15H20N4OS — CID 121335035
5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,3-thiazole-2,4-diamine (PubChem CID 121335035) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,3-thiazole-2,4-diamine.
| Compound Name | 5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 121335035 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1nc(N)c(-c2ccc(OCCN3CCCC3)cc2)s1 |
| InChI | InChI=1S/C15H20N4OS/c16-14-13(21-15(17)18-14)11-3-5-12(6-4-11)20-10-9-19-7-1-2-8-19/h3-6H,1-2,7-10,16H2,(H2,17,18) |
| InChIKey | UHTAQQGWFYVUQK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |